cas: 870487-10-8 — see every product listed under this CAS number, including other names
Boc-Val-Cit-PAB-PNP 98% (CAS 870487-10-8) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A479352-5mg |
| cas | 870487-10-8 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 175.69 Pln | |
| Ambeed | 10mg | 214.62 Pln | |
| Ambeed | 25mg | 342.56 Pln | |
| Ambeed | 100mg | 776.44 Pln | |
| Ambeed | 250mg | 1377.19 Pln | |
| Ambeed | 1g | 3541.00 Pln | |
| Ambeed | 5g | 10488.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A479352 |
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (CAS 870487-10-8) is a chemical compound with the molecular formula C30H40N6O10 and a molecular weight of 644.7 g/mol. IUPAC name: [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate. InChIKey: SKWLDDHVHXQPOG-ZEQRLZLVSA-N.
| Molecular formula | C30H40N6O10 |
|---|---|
| Molecular weight | 644.7 g/mol |
| IUPAC name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| InChIKey | SKWLDDHVHXQPOG-ZEQRLZLVSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)