cas: 1990504-34-1 — see every product listed under this CAS number, including other names
Bomedemstat 98% (CAS 1990504-34-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 100mg, 250mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1553559-1mg |
| cas | 1990504-34-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 392.62 Pln | |
| Ambeed | 100mg | 5766.00 Pln | |
| Ambeed | 250mg | 10332.81 Pln | |
| Ambeed | 5mg | 893.25 Pln | |
| Ambeed | 10mg | 1299.31 Pln | |
| Ambeed | 25mg | 2039.12 Pln | |
| Ambeed | 50mg | 3424.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1553559 |
N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]-4-(triazol-1-yl)benzamide (CAS 1990504-34-1) is a chemical compound with the molecular formula C28H34FN7O2 and a molecular weight of 519.6 g/mol. IUPAC name: N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]-4-(triazol-1-yl)benzamide. InChIKey: KQKBMHGOHXOHTD-KKUQBAQOSA-N.
| Molecular formula | C28H34FN7O2 |
|---|---|
| Molecular weight | 519.6 g/mol |
| IUPAC name | N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]-4-(triazol-1-yl)benzamide |
| InChIKey | KQKBMHGOHXOHTD-KKUQBAQOSA-N |
| SMILES | CN1CCN(CC1)C(=O)[C@H](CCCN[C@@H]2C[C@H]2C3=CC=C(C=C3)F)NC(=O)C4=CC=C(C=C4)N5C=CN=N5 |
Computed by PubChem (NCBI)