Bromo-PEG8-Boc 95%
cas: 1623792-00-6 — see every product listed under this CAS number, including other names
Bromo-PEG8-Boc 95% (CAS 1623792-00-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755436-100mg |
| cas | 1623792-00-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 948.88 Pln | |
| Ambeed | 5g | 2283.88 Pln | |
| Ambeed | 25g | 7829.69 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755436 |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1623792-00-6) is a chemical compound with the molecular formula C23H45BrO10 and a molecular weight of 561.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: DXYYTZDPNRZUDL-UHFFFAOYSA-N.
| Molecular formula | C23H45BrO10 |
|---|---|
| Molecular weight | 561.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | DXYYTZDPNRZUDL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCBr |
Computed by PubChem (NCBI)
Synonyms:
Bromo-PEG8-t-butyl ester, Bromo-PEG8-Boc, Br-PEG8-COOtBu, tert-butyl 1-bromo-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate, Bromo-PEG8-t-butylester, Br-PEG8-CH2CH2COOtBu, 1,1-Dimethylethyl 27-bromo-4,7,10,13,16,19,22,25-octaoxaheptacosanoate, C23H45BrO10, orb1989344, 2-Methyl-2-propanyl 1-bromo-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate