cas: 182244-33-3 — see every product listed under this CAS number, including other names
Bromoacetamido-C2-PEG2-NH-Boc 95% (CAS 182244-33-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754804-100mg |
| cas | 182244-33-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1093.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A754804 |
Tert-butyl N-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethyl]carbamate (CAS 182244-33-3) is a chemical compound with the molecular formula C13H25BrN2O5 and a molecular weight of 369.25 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethyl]carbamate. InChIKey: BLSNVTJXXUWHQT-UHFFFAOYSA-N.
| Molecular formula | C13H25BrN2O5 |
|---|---|
| Molecular weight | 369.25 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | BLSNVTJXXUWHQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)CBr |
Computed by PubChem (NCBI)