cas: 1807521-00-1 — see every product listed under this CAS number, including other names
Bromoacetamido-PEG4-C2-Boc 97% (CAS 1807521-00-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A677171-250mg |
| cas | 1807521-00-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1388.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A677171 |
Tert-butyl 3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1807521-00-1) is a chemical compound with the molecular formula C17H32BrNO7 and a molecular weight of 442.3 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: JKLVXGPHURQOIO-UHFFFAOYSA-N.
| Molecular formula | C17H32BrNO7 |
|---|---|
| Molecular weight | 442.3 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | JKLVXGPHURQOIO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)CBr |
Computed by PubChem (NCBI)