cas: 1260139-70-5 — see every product listed under this CAS number, including other names
Bromoacetamido-PEG4-NHS ester 96% (CAS 1260139-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A209171-100mg |
| cas | 1260139-70-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1722.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A209171 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1260139-70-5) is a chemical compound with the molecular formula C17H27BrN2O9 and a molecular weight of 483.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: BONNYNBXMCRXBJ-UHFFFAOYSA-N.
| Molecular formula | C17H27BrN2O9 |
|---|---|
| Molecular weight | 483.3 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | BONNYNBXMCRXBJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)CBr |
Computed by PubChem (NCBI)