cas: 1353011-78-5 — see every product listed under this CAS number, including other names
Bromoacetamido-peg2-nhs ester, 95%, 95% (CAS 1353011-78-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU1U-25mg |
| cas | 1353011-78-5 |
| size | 25mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 952.40 Pln | |
| Chemat | 50mg | 1480.40 Pln | |
| Chemat | 100mg | 2426.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoate (CAS 1353011-78-5) is a chemical compound with the molecular formula C13H19BrN2O7 and a molecular weight of 395.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoate. InChIKey: HDIXVXMKIWXBFA-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN2O7 |
|---|---|
| Molecular weight | 395.20 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoate |
| InChIKey | HDIXVXMKIWXBFA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCNC(=O)CBr |
Computed by PubChem (NCBI)