cas: 36457-20-2 — see every product listed under this CAS number, including other names
Butylparaben sodium, 98% (CAS 36457-20-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A285777-25g |
| cas | 36457-20-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 200.20 Pln | |
| AmBeed | 5g | 154.63 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Sodium 4-butoxycarbonylphenolate (CAS 36457-20-2) is a chemical compound with the molecular formula C11H13NaO3 and a molecular weight of 216.21 g/mol. IUPAC name: sodium 4-butoxycarbonylphenolate. InChIKey: OGBHACNFHJJTQT-UHFFFAOYSA-M.
| Molecular formula | C11H13NaO3 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | sodium 4-butoxycarbonylphenolate |
| InChIKey | OGBHACNFHJJTQT-UHFFFAOYSA-M |
| SMILES | CCCCOC(=O)C1=CC=C(C=C1)[O-].[Na+] |
Computed by PubChem (NCBI)