cas: 451-28-5 — see every product listed under this CAS number, including other names
Bz(4-F)-DL-Ala-OH 96% (CAS 451-28-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A171750-250mg |
| cas | 451-28-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 492.75 Pln | |
| Ambeed | 25g | 2183.75 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A171750 |
2-[(4-fluorobenzoyl)amino]propanoic acid (CAS 451-28-5) is a chemical compound with the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. IUPAC name: 2-[(4-fluorobenzoyl)amino]propanoic acid. InChIKey: RICKYTLEGMVQTI-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | 2-[(4-fluorobenzoyl)amino]propanoic acid |
| InChIKey | RICKYTLEGMVQTI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)