cas: 329198-87-0 — see every product listed under this CAS number, including other names
C-178 98% (CAS 329198-87-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A991151-1mg |
| cas | 329198-87-0 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 142.31 Pln | |
| Ambeed | 5mg | 209.06 Pln | |
| Ambeed | 25mg | 381.50 Pln | |
| Ambeed | 50mg | 576.19 Pln | |
| Ambeed | 100mg | 871.00 Pln | |
| Ambeed | 250mg | 1449.50 Pln | |
| Ambeed | 1g | 3585.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A991151 |
N-dibenzofuran-3-yl-5-nitrofuran-2-carboxamide (CAS 329198-87-0) is a chemical compound with the molecular formula C17H10N2O5 and a molecular weight of 322.27 g/mol. IUPAC name: N-dibenzofuran-3-yl-5-nitrofuran-2-carboxamide. InChIKey: URUVDCCYSJEGQQ-UHFFFAOYSA-N.
| Molecular formula | C17H10N2O5 |
|---|---|
| Molecular weight | 322.27 g/mol |
| IUPAC name | N-dibenzofuran-3-yl-5-nitrofuran-2-carboxamide |
| InChIKey | URUVDCCYSJEGQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)NC(=O)C4=CC=C(O4)[N+](=O)[O-] |
Computed by PubChem (NCBI)