cas: 1807503-91-8 — see every product listed under this CAS number, including other names
C-NH-Boc-C-Bis-(C-PEG1-Boc) 95% (CAS 1807503-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756417-100mg |
| cas | 1807503-91-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 1199.19 Pln | |
| Ambeed | 1g | 3040.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756417 |
Tert-butyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propoxy]propanoate (CAS 1807503-91-8) is a chemical compound with the molecular formula C22H41NO8 and a molecular weight of 447.6 g/mol. IUPAC name: tert-butyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propoxy]propanoate. InChIKey: AGLASZLADDHYAZ-UHFFFAOYSA-N.
| Molecular formula | C22H41NO8 |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propoxy]propanoate |
| InChIKey | AGLASZLADDHYAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCC(COCCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)