cas: 432001-19-9 — see every product listed under this CAS number, including other names
C188-9 98% (CAS 432001-19-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A445130-1mg |
| cas | 432001-19-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 225.75 Pln | |
| Ambeed | 5mg | 431.56 Pln | |
| Ambeed | 10mg | 565.06 Pln | |
| Ambeed | 25mg | 915.50 Pln | |
| Ambeed | 50mg | 1338.25 Pln | |
| Ambeed | 100mg | 2217.12 Pln | |
| Ambeed | 250mg | 3719.00 Pln | |
| Ambeed | 1g | 9937.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A445130 |
N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-4-methoxybenzenesulfonamide (CAS 432001-19-9) is a chemical compound with the molecular formula C27H21NO5S and a molecular weight of 471.5 g/mol. IUPAC name: N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-4-methoxybenzenesulfonamide. InChIKey: QDCJDYWGYVPBDO-UHFFFAOYSA-N.
| Molecular formula | C27H21NO5S |
|---|---|
| Molecular weight | 471.5 g/mol |
| IUPAC name | N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-4-methoxybenzenesulfonamide |
| InChIKey | QDCJDYWGYVPBDO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C3=CC=CC=C32)O)C4=C(C=CC5=CC=CC=C54)O |
Computed by PubChem (NCBI)