CAY10464
cas: 688348-37-0 — see every product listed under this CAS number, including other names
CAY10464 (CAS 688348-37-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 50mg, 5mg, 500mg, 2mg. Offered by: GLPBio, TargetMol, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC43159-10 |
| cas | 688348-37-0 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 554.92 Pln | |
| GLPBio | 100mg | 1509.74 Pln | |
| GLPBio | 25mg | 737.45 Pln | |
| GLPBio | 50mg | 1032.33 Pln | |
| TargetMol | 5mg | 452.11 Pln | |
| TargetMol | 10mg | 598.57 Pln | |
| TargetMol | 25mg | 1009.99 Pln | |
| TargetMol | 50mg | 1541.60 Pln | |
| TargetMol | 100mg | 2205.69 Pln | |
| TargetMol | 500mg | 4987.84 Pln | |
| Chemat | 2mg | 150.80 Pln | |
| Chemat | 5mg | 208.40 Pln | |
| Chemat | 10mg | 299.60 Pln | |
| Chemat | 25mg | 544.40 Pln | |
| Chemat | 50mg | 846.80 Pln | |
| Chemat | 100mg | 1245.20 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-dichloro-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene (CAS 688348-37-0) is a chemical compound with the molecular formula C15H12Cl2O and a molecular weight of 279.2 g/mol. IUPAC name: 1,3-dichloro-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene. InChIKey: YDVZIQMQLZBUKX-NSCUHMNNSA-N.
| Molecular formula | C15H12Cl2O |
|---|---|
| Molecular weight | 279.2 g/mol |
| IUPAC name | 1,3-dichloro-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
| InChIKey | YDVZIQMQLZBUKX-NSCUHMNNSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
1,3-dichloro-5-[(1E)-2-(4-methoxyphenyl)ethenyl]-benzene, AHR antagonist 7, 1,3-dichloro-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene, 1,3-Dichloro-5-(4-methoxystyryl)benzene, 1,3-dichloro-5-[(1E)-2-(4-methoxyphenyl)ethenyl]benzene, trans-Stilbene Derivative, 4j, orb2283690, 1,3-dichloro-5-[(E)-2-(4-methoxyphenyl)vinyl]benzene