CAS 638156-11-3 appears in our catalog under these names: CID 2011756/ 98.15% (existing batch purity), CID 2011756, CID-2011756, 97%, 97%, CID 2011756, 96.98%, CID-2011756, ≥98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso), 100 mg.
5-(3-chlorophenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]furan-2-carboxamide (CAS 638156-11-3) is a chemical compound with the molecular formula C22H21ClN2O3 and a molecular weight of 396.9 g/mol. IUPAC name: 5-(3-chlorophenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]furan-2-carboxamide. InChIKey: XQJWTJLJEYIUDZ-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN2O3 |
|---|---|
| Molecular weight | 396.9 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]furan-2-carboxamide |
| InChIKey | XQJWTJLJEYIUDZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CC=C(C=C2)NC(=O)C3=CC=C(O3)C4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)