cas: 388592-44-7 — see every product listed under this CAS number, including other names
CK-869 98+% (CAS 388592-44-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1001760-1mg |
| cas | 388592-44-7 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 159.00 Pln | |
| Ambeed | 5mg | 248.00 Pln | |
| Ambeed | 10mg | 314.75 Pln | |
| Ambeed | 25mg | 481.62 Pln | |
| Ambeed | 50mg | 731.94 Pln | |
| Ambeed | 100mg | 1071.25 Pln | |
| Ambeed | 250mg | 1694.25 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1001760 |
2-(3-bromophenyl)-3-(2,4-dimethoxyphenyl)-1,3-thiazolidin-4-one (CAS 388592-44-7) is a chemical compound with the molecular formula C17H16BrNO3S and a molecular weight of 394.3 g/mol. IUPAC name: 2-(3-bromophenyl)-3-(2,4-dimethoxyphenyl)-1,3-thiazolidin-4-one. InChIKey: MVWNPZYLNLATCH-UHFFFAOYSA-N.
| Molecular formula | C17H16BrNO3S |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | 2-(3-bromophenyl)-3-(2,4-dimethoxyphenyl)-1,3-thiazolidin-4-one |
| InChIKey | MVWNPZYLNLATCH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N2C(SCC2=O)C3=CC(=CC=C3)Br)OC |
Computed by PubChem (NCBI)