cas: 9001-12-1 — see every product listed under this CAS number, including other names
COLLAGENASE FROM CLOSTRIDIUM HISTOLYT& (CAS 9001-12-1) is a chemical reagent available from Chemat. Available pack sizes: 100MG, 1G, 25MG, 500MG, 5G, 1.5KU, 15KU, 3KU. Offered by: Sigma-Aldrich.
| brand | Sigma-Aldrich |
|---|---|
| catalog number | C9407-100MG |
| cas | 9001-12-1 |
| size | 100MG |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Sigma-Aldrich | 100MG | 1150.00 Pln | |
| Sigma-Aldrich | 1G | 5660.00 Pln | |
| Sigma-Aldrich | 25MG | 396.00 Pln | |
| Sigma-Aldrich | 500MG | 3720.00 Pln | |
| Sigma-Aldrich | 5G | 20660.00 Pln | |
| Sigma-Aldrich | 1.5KU | 436.00 Pln | |
| Sigma-Aldrich | 15KU | 2710.00 Pln | |
| Sigma-Aldrich | 3KU | 781.00 Pln | |
| Sigma-Aldrich | 60KU | 8430.00 Pln | |
| Sigma-Aldrich | 7.5KU | 1520.00 Pln | |
| Sigma-Aldrich | 15KU | 3110.00 Pln | |
| Sigma-Aldrich | 7.5KU | 4360.00 Pln |
| purity | No data |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(5S,6S,9R,10S,13S,17S,23S,24S,27R,28S,31S,35S)-5,6,9,13,17,23,24,27,31,35-decamethyl-10,28-dioctyl-2,20-diazanonacyclo[19.15.0.03,19.05,17.06,14.09,13.023,35.024,32.027,31]hexatriaconta-1(21),2,19-triene (CAS 9001-12-1) is a chemical compound with the molecular formula C60H100N2 and a molecular weight of 849.4 g/mol. IUPAC name: (5S,6S,9R,10S,13S,17S,23S,24S,27R,28S,31S,35S)-5,6,9,13,17,23,24,27,31,35-decamethyl-10,28-dioctyl-2,20-diazanonacyclo[19.15.0.03,19.05,17.06,14.09,13.023,35.024,32.027,31]hexatriaconta-1(21),2,19-triene. InChIKey: YRQNKMKHABXEJZ-UVQQGXFZSA-N.
| Molecular formula | C60H100N2 |
|---|---|
| Molecular weight | 849.4 g/mol |
| IUPAC name | (5S,6S,9R,10S,13S,17S,23S,24S,27R,28S,31S,35S)-5,6,9,13,17,23,24,27,31,35-decamethyl-10,28-dioctyl-2,20-diazanonacyclo[19.15.0.03,19.05,17.06,14.09,13.023,35.024,32.027,31]hexatriaconta-1(21),2,19-triene |
| InChIKey | YRQNKMKHABXEJZ-UVQQGXFZSA-N |
| SMILES | CCCCCCCC[C@H]1CC[C@@]2([C@@]1(CC[C@]3(C2CC[C@@]4([C@@]3(CC5=C(C4)N=C6C[C@]7([C@@](CCC8[C@@]7(CC[C@]9([C@]8(CC[C@@H]9CCCCCCCC)C)C)C)(CC6=N5)C)C)C)C)C)C)C |
Computed by PubChem (NCBI)