cas: 73837-24-8 — see every product listed under this CAS number, including other names
Calcitriol Impurities A 99% (CAS 73837-24-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A434606-1mg |
| cas | 73837-24-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 364.81 Pln | |
| Ambeed | 5mg | 509.44 Pln | |
| Ambeed | 10mg | 637.38 Pln | |
| Ambeed | 25mg | 1149.12 Pln | |
| Ambeed | 50mg | 1894.50 Pln | |
| Ambeed | 100mg | 3168.31 Pln | |
| Ambeed | 250mg | 5955.12 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A434606 |
Trans-(1R,3S,5E)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (CAS 73837-24-8) is a chemical compound with the molecular formula C27H44O3 and a molecular weight of 416.6 g/mol. IUPAC name: trans-(1R,3S,5E)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol. InChIKey: GMRQFYUYWCNGIN-DRQJEBLXSA-N.
| Molecular formula | C27H44O3 |
|---|---|
| Molecular weight | 416.6 g/mol |
| IUPAC name | trans-(1R,3S,5E)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| InChIKey | GMRQFYUYWCNGIN-DRQJEBLXSA-N |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C\3/C[C@H](C[C@@H](C3=C)O)O)C |
Computed by PubChem (NCBI)