cas: 135236-72-5 — see every product listed under this CAS number, including other names
Calcium 3-hydroxy-3-methylbutanoate hydrate, 98% (CAS 135236-72-5) is a chemical reagent available from Chemat. Available pack sizes: 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F988453-250G |
| cas | 135236-72-5 |
| size | 250g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250g | 237.43 Pln | |
| Fluorochem | 500g | 294.71 Pln | |
| Fluorochem | 1kg | 534.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Calcium bis(3-hydroxy-3-methylbutanoate) (CAS 135236-72-5) is a chemical compound with the molecular formula C10H18CaO6 and a molecular weight of 274.32 g/mol. IUPAC name: calcium bis(3-hydroxy-3-methylbutanoate). InChIKey: WLJUMPWVUPNXMF-UHFFFAOYSA-L.
| Molecular formula | C10H18CaO6 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | calcium bis(3-hydroxy-3-methylbutanoate) |
| InChIKey | WLJUMPWVUPNXMF-UHFFFAOYSA-L |
| SMILES | CC(C)(CC(=O)[O-])O.CC(C)(CC(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)