cas: 3147-14-6 — see every product listed under this CAS number, including other names
Calmagite (CAS 3147-14-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 25g, 5g, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | CM22440T-100g |
| cas | 3147-14-6 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 1093.99 Pln | |
| Chemat | 10g | 246.53 Pln | |
| Chemat | 25g | 444.00 Pln | |
| Chemat | 5g | 158.05 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 328.40 Pln | |
| Chemat | 100g | 750.80 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 25g | 539.41 Pln | |
| Fluorochem | 100g | 1257.91 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
3-hydroxy-4-[(2-hydroxy-5-methylphenyl)diazenyl]naphthalene-1-sulfonic acid (CAS 3147-14-6) is a chemical compound with the molecular formula C17H14N2O5S and a molecular weight of 358.4 g/mol. IUPAC name: 3-hydroxy-4-[(2-hydroxy-5-methylphenyl)diazenyl]naphthalene-1-sulfonic acid. InChIKey: VBRNLOQCBCPPHL-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O5S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 3-hydroxy-4-[(2-hydroxy-5-methylphenyl)diazenyl]naphthalene-1-sulfonic acid |
| InChIKey | VBRNLOQCBCPPHL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)N=NC2=C(C=C(C3=CC=CC=C32)S(=O)(=O)O)O |
Computed by PubChem (NCBI)