cas: 102089-74-7 — see every product listed under this CAS number, including other names
Carbamic acid, N- [(1R)-2-hydroxy-1- phenylethyl]-, 1,1- dimethylethyl ester, 97%, 97% (CAS 102089-74-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1117LR-1g |
| cas | 102089-74-7 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 98.00 Pln | |
| Chemat | 100g | 131.60 Pln | |
| Chemat | 250g | 208.40 Pln | |
| Chemat | 500g | 408.00 Pln | |
| Chemat | 1kg | 717.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate (CAS 102089-74-7) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: tert-butyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate. InChIKey: IBDIOGYTZBKRGI-NSHDSACASA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | tert-butyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate |
| InChIKey | IBDIOGYTZBKRGI-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C1=CC=CC=C1 |
Computed by PubChem (NCBI)