Carboxyamidotriazole Orotate
cas: 187739-60-2 — see every product listed under this CAS number, including other names
Carboxyamidotriazole Orotate (CAS 187739-60-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC39646-1 |
| cas | 187739-60-2 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 690.65 Pln | |
| GLPBio | 10mg | 1425.49 Pln | |
| GLPBio | 25mg | 2141.60 Pln | |
| GLPBio | 5mg | 1088.49 Pln | |
| GLPBio | 50mg | 2857.72 Pln | |
| Chemat | 1mg | 208.40 Pln | |
| Chemat | 5mg | 434.00 Pln | |
| Chemat | 10mg | 626.00 Pln | |
| Chemat | 25mg | 1024.40 Pln | |
| Chemat | 50mg | 1432.40 Pln | |
| Chemat | 100mg | 1994.00 Pln | |
| Chemat | 200mg | 2685.20 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-amino-1-[[3,5-dichloro-4-(4-chlorobenzoyl)phenyl]methyl]triazole-4-carboxamide;2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 187739-60-2) is a chemical compound with the molecular formula C22H16Cl3N7O6 and a molecular weight of 580.8 g/mol. IUPAC name: 5-amino-1-[[3,5-dichloro-4-(4-chlorobenzoyl)phenyl]methyl]triazole-4-carboxamide;2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: MNWOBDDXRRBONM-UHFFFAOYSA-N.
| Molecular formula | C22H16Cl3N7O6 |
|---|---|
| Molecular weight | 580.8 g/mol |
| IUPAC name | 5-amino-1-[[3,5-dichloro-4-(4-chlorobenzoyl)phenyl]methyl]triazole-4-carboxamide;2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | MNWOBDDXRRBONM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2Cl)CN3C(=C(N=N3)C(=O)N)N)Cl)Cl.C1=C(NC(=O)NC1=O)C(=O)O |
Computed by PubChem (NCBI)