cas: 64187-48-0 — see every product listed under this CAS number, including other names
Cbz-Hyp-OMe 97% (CAS 64187-48-0) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 5g, 10g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A101081-1000g |
| cas | 64187-48-0 |
| size | 1000g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2333.94 Pln | |
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 136.75 Pln | |
| Ambeed | 100g | 359.25 Pln | |
| Ambeed | 500g | 1482.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A101081 |
1-O-benzyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 64187-48-0) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: VVKAGQHUUDRPOI-NEPJUHHUSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | VVKAGQHUUDRPOI-NEPJUHHUSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)