CAS 2578-84-9 appears in our catalog under these names: Z-Phe-onp, 98%, Z-PHE-ONP, Z–Phe–ONp, Z-Phe-ONp, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 5g, 10g, 1g, 2,5g, 250mg, 500mg, 25g.
(4-nitrophenyl) (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (CAS 2578-84-9) is a chemical compound with the molecular formula C23H20N2O6 and a molecular weight of 420.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: TVENQUPLPBPLGU-NRFANRHFSA-N.
| Molecular formula | C23H20N2O6 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | TVENQUPLPBPLGU-NRFANRHFSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)