CAS 10294-54-9 appears in our catalog under these names: Cesium sulfate, 98%, Cesium sulfate, 99.997 %, Cesium sulfate/ 99.5%, Cesium sulfate/ 99.9%, Cesium sulfate/ 99.99%. Offered by: Combi-blocks, Chemat Brand, Chemat, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 25g, 100g, 500g, 5g, on request, 50g, 250g.
Dicesium;sulfate (CAS 10294-54-9) is a chemical compound with the molecular formula Cs2O4S and a molecular weight of 361.88 g/mol. IUPAC name: dicesium;sulfate. InChIKey: FLJPGEWQYJVDPF-UHFFFAOYSA-L.
| Molecular formula | Cs2O4S |
|---|---|
| Molecular weight | 361.88 g/mol |
| IUPAC name | dicesium;sulfate |
| InChIKey | FLJPGEWQYJVDPF-UHFFFAOYSA-L |
| SMILES | [O-]S(=O)(=O)[O-].[Cs+].[Cs+] |
Computed by PubChem (NCBI)