Chaetocin 98+%
cas: 28097-03-2 — see every product listed under this CAS number, including other names
Chaetocin 98+% (CAS 28097-03-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A595022-1mg |
| cas | 28097-03-2 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 681.88 Pln | |
| Ambeed | 5mg | 1950.12 Pln | |
| Ambeed | 10mg | 3357.44 Pln | |
| Ambeed | 25mg | 6650.44 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A595022 |
(1S,3R,11R,14S)-14-(hydroxymethyl)-3-[(1S,3R,11R,14S)-14-(hydroxymethyl)-18-methyl-13,17-dioxo-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-trien-3-yl]-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione (CAS 28097-03-2) is a chemical compound with the molecular formula C30H28N6O6S4 and a molecular weight of 696.8 g/mol. IUPAC name: (1S,3R,11R,14S)-14-(hydroxymethyl)-3-[(1S,3R,11R,14S)-14-(hydroxymethyl)-18-methyl-13,17-dioxo-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-trien-3-yl]-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione. InChIKey: PZPPOCZWRGNKIR-PNVYSBBASA-N.
| Molecular formula | C30H28N6O6S4 |
|---|---|
| Molecular weight | 696.8 g/mol |
| IUPAC name | (1S,3R,11R,14S)-14-(hydroxymethyl)-3-[(1S,3R,11R,14S)-14-(hydroxymethyl)-18-methyl-13,17-dioxo-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-trien-3-yl]-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione |
| InChIKey | PZPPOCZWRGNKIR-PNVYSBBASA-N |
| SMILES | CN1C(=O)[C@@]23C[C@]4([C@@H](N2C(=O)[C@@]1(SS3)CO)NC5=CC=CC=C54)[C@]67C[C@]89C(=O)N([C@](C(=O)N8[C@H]6NC1=CC=CC=C71)(SS9)CO)C |
Computed by PubChem (NCBI)