cas: 873779-78-3 — see every product listed under this CAS number, including other names
Chloro[1,3-Bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]copper(I) 97% (CAS 873779-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A422154-100g |
| cas | 873779-78-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 14788.38 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1299.31 Pln | |
| Ambeed | 25g | 4670.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A422154 |
1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-1-ium-2-ide;copper(1+);chloride (CAS 873779-78-3) is a chemical compound with the molecular formula C21H24ClCuN2 and a molecular weight of 403.4 g/mol. IUPAC name: 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-1-ium-2-ide;copper(1+);chloride. InChIKey: JMQRNHTTZWNLMH-UHFFFAOYSA-M.
| Molecular formula | C21H24ClCuN2 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-1-ium-2-ide;copper(1+);chloride |
| InChIKey | JMQRNHTTZWNLMH-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=C[N+](=[C-]2)C3=C(C=C(C=C3C)C)C)C.[Cl-].[Cu+] |
Computed by PubChem (NCBI)