Chlortetracycline (hydrochloride), 95.0%
cas: 64-72-2 — see every product listed under this CAS number, including other names
Chlortetracycline (hydrochloride), 95.0% (CAS 64-72-2) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B1327-5 g |
| cas | 64-72-2 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 310.40 Pln | |
| MedChemExpress | 1 g | 240.74 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 95.0% |
(4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride (CAS 64-72-2) is a chemical compound with the molecular formula C22H24Cl2N2O8 and a molecular weight of 515.3 g/mol. IUPAC name: (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride. InChIKey: QYAPHLRPFNSDNH-MRFRVZCGSA-N.
| Molecular formula | C22H24Cl2N2O8 |
|---|---|
| Molecular weight | 515.3 g/mol |
| IUPAC name | (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
| InChIKey | QYAPHLRPFNSDNH-MRFRVZCGSA-N |
| SMILES | C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O.Cl |
Computed by PubChem (NCBI)