cas: 633-31-8 — see every product listed under this CAS number, including other names
Cholest-5-en-3-ol (3β)-, 3-propanoate, 97%, 97% (CAS 633-31-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 15g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OUT-1g |
| cas | 633-31-8 |
| size | 1g |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 25g | 515.60 Pln | |
| Chemat | 100g | 1701.20 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 15g | 400.40 Pln | |
| Chemat | 50g | 928.40 Pln | |
| Chemat | 75g | 1346.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanoate (CAS 633-31-8) is a chemical compound with the molecular formula C30H50O2 and a molecular weight of 442.7 g/mol. IUPAC name: [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanoate. InChIKey: CCORPVHYPHHRKB-NXUCFJMCSA-N.
| Molecular formula | C30H50O2 |
|---|---|
| Molecular weight | 442.7 g/mol |
| IUPAC name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanoate |
| InChIKey | CCORPVHYPHHRKB-NXUCFJMCSA-N |
| SMILES | CCC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CC[C@@H]4[C@H](C)CCCC(C)C)C)C |
Computed by PubChem (NCBI)