cas: 2126-93-4 — see every product listed under this CAS number, including other names
Cholesterylamine, 95%, 95% (CAS 2126-93-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BO90-5mg |
| cas | 2126-93-4 |
| size | 5mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 515.60 Pln | |
| Chemat | 10mg | 784.40 Pln | |
| Chemat | 25mg | 1302.80 Pln | |
| Chemat | 100mg | 1715.60 Pln | |
| Chemat | 250mg | 4058.00 Pln | |
| Chemat | 1g | 7816.40 Pln | |
| Chemat | 5g | 14709.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine (CAS 2126-93-4) is a chemical compound with the molecular formula C27H47N and a molecular weight of 385.7 g/mol. IUPAC name: (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine. InChIKey: YGPZWPHDULZYFR-DPAQBDIFSA-N.
| Molecular formula | C27H47N |
|---|---|
| Molecular weight | 385.7 g/mol |
| IUPAC name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
| InChIKey | YGPZWPHDULZYFR-DPAQBDIFSA-N |
| SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)N)C)C |
Computed by PubChem (NCBI)