cas: 149423-70-1 — see every product listed under this CAS number, including other names
Cis-1-N-Cbz-1,4-Cyclohexyldiamine (CAS 149423-70-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049014-250MG |
| cas | 149423-70-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1356.83 Pln |
| delivery time | 3-4 weeks |
|---|
Benzyl N-(4-aminocyclohexyl)carbamate (CAS 149423-70-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-(4-aminocyclohexyl)carbamate. InChIKey: JQVBZZUMWRXDSQ-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-(4-aminocyclohexyl)carbamate |
| InChIKey | JQVBZZUMWRXDSQ-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)