cas: 59729-32-7 — see every product listed under this CAS number, including other names
Citalopram hydrobromide, 98%, 98% (CAS 59729-32-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IALI-100mg |
| cas | 59729-32-7 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Chemat | 100g | 2128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrobromide (CAS 59729-32-7) is a chemical compound with the molecular formula C20H22BrFN2O and a molecular weight of 405.3 g/mol. IUPAC name: 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrobromide. InChIKey: WIHMBLDNRMIGDW-UHFFFAOYSA-N.
| Molecular formula | C20H22BrFN2O |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrobromide |
| InChIKey | WIHMBLDNRMIGDW-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F.Br |
Computed by PubChem (NCBI)