cas: 14024-48-7 — see every product listed under this CAS number, including other names
Cobalt(II) acetylacetonate, 96% (CAS 14024-48-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552389-25G |
| cas | 14024-48-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 143.72 Pln | |
| Fluorochem | 500g | 372.80 Pln | |
| Fluorochem | 1kg | 591.48 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Cobalt(II) bis(acetylacetonate) is a cobalt coordination entity in which two molecules of 2,4-dioxopentan-3-ide form a coordination complex with cobalt(2+). It has a role as a catalyst.
Source: ChEBI
| Molecular formula | C10H14CoO4 |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | cobalt(2+);bis(pentane-2,4-dione) |
| InChIKey | BKFAZDGHFACXKY-UHFFFAOYSA-N |
| SMILES | CC(=O)[CH-]C(=O)C.CC(=O)[CH-]C(=O)C.[Co+2] |
Computed by PubChem (NCBI)