cas: 58164-61-7 — see every product listed under this CAS number, including other names
Cobalt(II)trifluoromethanesulfonate, 98% (CAS 58164-61-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552342-1G |
| cas | 58164-61-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 25g | 497.76 Pln | |
| Fluorochem | 100g | 1731.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Cobalt(2+);bis(trifluoromethanesulfonate) (CAS 58164-61-7) is a chemical compound with the molecular formula C2CoF6O6S2 and a molecular weight of 357.08 g/mol. IUPAC name: cobalt(2+);bis(trifluoromethanesulfonate). InChIKey: RDLMYNHWUFIVQE-UHFFFAOYSA-L.
| Molecular formula | C2CoF6O6S2 |
|---|---|
| Molecular weight | 357.08 g/mol |
| IUPAC name | cobalt(2+);bis(trifluoromethanesulfonate) |
| InChIKey | RDLMYNHWUFIVQE-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Co+2] |
Computed by PubChem (NCBI)