Compound 1T-0216
cas: 383147-88-4 — see every product listed under this CAS number, including other names
Compound 1T-0216 (CAS 383147-88-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T9544-1mg |
| cas | 383147-88-4 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 757.88 Pln | |
| TargetMol | 5mg | 1468.37 Pln | |
| TargetMol | 10mg | 2079.36 Pln | |
| TargetMol | 25mg | 3201.83 Pln | |
| TargetMol | 50mg | 4476.91 Pln | |
| TargetMol | 100mg | 5950.99 Pln | |
| TargetMol | 200mg | 7896.87 Pln | |
| Chemat | 200mg | 4806.80 Pln | |
| Chemat | 1mg | 280.40 Pln | |
| Chemat | 5mg | 558.80 Pln | |
| Chemat | 10mg | 798.80 Pln | |
| Chemat | 25mg | 1235.60 Pln | |
| Chemat | 50mg | 1658.00 Pln | |
| Chemat | 100mg | 2224.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
[(E)-[2-(2,4-dinitrophenyl)cyclohexylidene]amino] 2-methylbenzoate (CAS 383147-88-4) is a chemical compound with the molecular formula C20H19N3O6 and a molecular weight of 397.4 g/mol. IUPAC name: [(E)-[2-(2,4-dinitrophenyl)cyclohexylidene]amino] 2-methylbenzoate. InChIKey: KDGAEPGEQCZROO-DYTRJAOYSA-N.
| Molecular formula | C20H19N3O6 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | [(E)-[2-(2,4-dinitrophenyl)cyclohexylidene]amino] 2-methylbenzoate |
| InChIKey | KDGAEPGEQCZROO-DYTRJAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)O/N=C/2\CCCCC2C3=C(C=C(C=C3)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Compound 1T-0216, [(E)-[2-(2,4-dinitrophenyl)cyclohexylidene]amino] 2-methylbenzoate, [(1E)-2-(2,4-dinitrophenyl)cyclohexylidene]amino 2-methylbenzoate, orb1298031, [(1E)-2-(2,4-dinitrophenyl)cyclohexylidene]amino2-methylbenzoate, 2-(2,4-Dinitrophenyl)cyclohexan-1-one O-(2-methylbenzoyl) oxime