cas: 1384860-29-0 — see every product listed under this CAS number, including other names
Conteltinib 98% (CAS 1384860-29-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1176661-1mg |
| cas | 1384860-29-0 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 342.56 Pln | |
| Ambeed | 5mg | 670.75 Pln | |
| Ambeed | 10mg | 1026.75 Pln | |
| Ambeed | 25mg | 1972.38 Pln | |
| Ambeed | 50mg | 2745.56 Pln | |
| Ambeed | 100mg | 3796.88 Pln | |
| Ambeed | 250mg | 8997.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1176661 |
2-[[2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide (CAS 1384860-29-0) is a chemical compound with the molecular formula C32H45N9O3S and a molecular weight of 635.8 g/mol. IUPAC name: 2-[[2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide. InChIKey: NPJCURIANJMFEO-UHFFFAOYSA-N.
| Molecular formula | C32H45N9O3S |
|---|---|
| Molecular weight | 635.8 g/mol |
| IUPAC name | 2-[[2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide |
| InChIKey | NPJCURIANJMFEO-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=CC=C1NC2=NC(=NC3=C2CCN3)NC4=C(C=C(C=C4)N5CCC(CC5)N6CCN(CC6)C)OC |
Computed by PubChem (NCBI)