CAS 23670-45-3 appears in our catalog under these names: COPPER(II) TERT-BUTYLACETOACETATE, 97%, Copper(II) tert-butylacetoacetate, 98%, 98%, Bis(t-butylacetoacetato)copper(II), 98%. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10G, 100mg, 250mg, 1g, 5g, 25g, 100g.
Bis(tert-butyl (Z)-3-hydroxybut-2-enoate);copper (CAS 23670-45-3) is a chemical compound with the molecular formula C16H28CuO6 and a molecular weight of 379.94 g/mol. IUPAC name: bis(tert-butyl (Z)-3-hydroxybut-2-enoate);copper. InChIKey: DXRDXEFLVDSSAL-VKRZFSCASA-N.
| Molecular formula | C16H28CuO6 |
|---|---|
| Molecular weight | 379.94 g/mol |
| IUPAC name | bis(tert-butyl (Z)-3-hydroxybut-2-enoate);copper |
| InChIKey | DXRDXEFLVDSSAL-VKRZFSCASA-N |
| SMILES | C/C(=C/C(=O)OC(C)(C)C)/O.C/C(=C/C(=O)OC(C)(C)C)/O.[Cu] |
Computed by PubChem (NCBI)