cas: 877399-74-1 — see every product listed under this CAS number, including other names
Crizotinib Impurity 5 98% (CAS 877399-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153059-100mg |
| cas | 877399-74-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 292.50 Pln | |
| Ambeed | 25g | 337.00 Pln | |
| Ambeed | 100g | 937.75 Pln | |
| Ambeed | 500g | 4364.25 Pln | |
| Ambeed | 1000g | 8647.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A153059 |
Tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate (CAS 877399-74-1) is a chemical compound with the molecular formula C19H32BN3O4 and a molecular weight of 377.3 g/mol. IUPAC name: tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate. InChIKey: QSQWENQPOSRWLP-UHFFFAOYSA-N.
| Molecular formula | C19H32BN3O4 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
| InChIKey | QSQWENQPOSRWLP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)