CAS 185827-91-2 appears in our catalog under these names: Bis(dimethylamino–2–propoxy)copper(II), Bis(dimethylamino-2-propoxy)copper(II), 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 1g.
Copper bis(1-(dimethylamino)propan-2-ol) (CAS 185827-91-2) is a chemical compound with the molecular formula C10H26CuN2O2+2 and a molecular weight of 269.87 g/mol. IUPAC name: copper bis(1-(dimethylamino)propan-2-ol). InChIKey: DMVVGZLAQBSSCF-UHFFFAOYSA-N.
| Molecular formula | C10H26CuN2O2+2 |
|---|---|
| Molecular weight | 269.87 g/mol |
| IUPAC name | copper bis(1-(dimethylamino)propan-2-ol) |
| InChIKey | DMVVGZLAQBSSCF-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)O.CC(CN(C)C)O.[Cu+2] |
Computed by PubChem (NCBI)