cas: 13306-05-3 — see every product listed under this CAS number, including other names
Cyanidin, 25% (CAS 13306-05-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1g, 5g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A663787-25g |
| cas | 13306-05-3 |
| size | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 498.31 Pln | |
| Ambeed | 100g | 776.44 Pln | |
| Ambeed | 500g | 2206.00 Pln | |
| Fluorochem | 1g | 242.64 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 25g | 1013.20 Pln | |
| Fluorochem | 100g | 1637.98 Pln | |
| Fluorochem | 500g | 4704.61 Pln |
| purity | 25% |
|---|---|
| delivery time | 2-3 weeks |
2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol (CAS 13306-05-3) is a chemical compound with the molecular formula C15H11O6+ and a molecular weight of 287.24 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol. InChIKey: VEVZSMAEJFVWIL-UHFFFAOYSA-O.
| Molecular formula | C15H11O6+ |
|---|---|
| Molecular weight | 287.24 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol |
| InChIKey | VEVZSMAEJFVWIL-UHFFFAOYSA-O |
| SMILES | C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O)O |
Computed by PubChem (NCBI)