CAS 1167421-28-4 appears in our catalog under these names: Cyanine3 azide chloride, Cyanine3 azide (chloride), 99%, 99%, Cyanine3 azide (chloride), 99.44%, Cyanine3 azide, 95%, Cyanine3 azide. Offered by: GLPBio, Chemat, MedChemExpress, Lumiprobe. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 10 mg, 5 mg, 100ul, 10 mM/DMSO, 500ul, 10 mM/DMSO.
N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanamide chloride (CAS 1167421-28-4) is a chemical compound with the molecular formula C33H43ClN6O and a molecular weight of 575.2 g/mol. IUPAC name: N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanamide chloride. InChIKey: JWFYJJIXFMMPNH-UHFFFAOYSA-N.
| Molecular formula | C33H43ClN6O |
|---|---|
| Molecular weight | 575.2 g/mol |
| IUPAC name | N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanamide chloride |
| InChIKey | JWFYJJIXFMMPNH-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C/3\C(C4=CC=CC=C4N3CCCCCC(=O)NCCCN=[N+]=[N-])(C)C)C)C.[Cl-] |
Computed by PubChem (NCBI)