CAS 35309-53-6 appears in our catalog under these names: Aspartate ornithine Impurity 9, CYCLO(-ASP-ASP), Cyclo(–Asp–Asp), Cyclo(Asp-Asp), Cyclo(-Asp-Asp) trifluoroacetic acid. Offered by: Chemat Brand, GLPBio, MedChemExpress, Biosynth. Available pack sizes: on request, 250mg, 50mg, Get quote, 0,5g, 0,25g, 1g, 2g.
2-[(2S,5S)-5-(carboxymethyl)-3,6-dioxopiperazin-2-yl]acetic acid (CAS 35309-53-6) is a chemical compound with the molecular formula C8H10N2O6 and a molecular weight of 230.17 g/mol. IUPAC name: 2-[(2S,5S)-5-(carboxymethyl)-3,6-dioxopiperazin-2-yl]acetic acid. InChIKey: NMAZZUSURHBTKP-IMJSIDKUSA-N.
| Molecular formula | C8H10N2O6 |
|---|---|
| Molecular weight | 230.17 g/mol |
| IUPAC name | 2-[(2S,5S)-5-(carboxymethyl)-3,6-dioxopiperazin-2-yl]acetic acid |
| InChIKey | NMAZZUSURHBTKP-IMJSIDKUSA-N |
| SMILES | C([C@H]1C(=O)N[C@H](C(=O)N1)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)