cas: 115144-35-9 — see every product listed under this CAS number, including other names
D-Luciferin potassium 97% (CAS 115144-35-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A162108-1mg |
| cas | 115144-35-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 10mg | 197.94 Pln | |
| Ambeed | 25mg | 220.19 Pln | |
| Ambeed | 50mg | 253.56 Pln | |
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 787.56 Pln | |
| Ambeed | 5g | 2550.88 Pln | |
| Ambeed | 10g | 3785.75 Pln | |
| Ambeed | 25g | 7924.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A162108 |
Potassium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate (CAS 115144-35-9) is a chemical compound with the molecular formula C11H7KN2O3S2 and a molecular weight of 318.4 g/mol. IUPAC name: potassium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate. InChIKey: UMBKGTQQGYPQBE-OGFXRTJISA-M.
| Molecular formula | C11H7KN2O3S2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | potassium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| InChIKey | UMBKGTQQGYPQBE-OGFXRTJISA-M |
| SMILES | C1[C@@H](N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)