cas: 287112-34-9 — see every product listed under this CAS number, including other names
D-Mannitol-13C6, ≥99 atom% 13C,≥98%, ≥99 atom% 13C,≥98% (CAS 287112-34-9) is a chemical reagent available from Chemat. Available pack sizes: 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BBRI-5mg |
| cas | 287112-34-9 |
| size | 5mg |
| availability | 0.01g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 611.60 Pln |
| purity | ≥99 atom% 13C,≥98% |
|---|---|
| delivery time | 3 weeks |
(2R,3R,4R,5R)-(1,2,3,4,5,6-13C6)hexane-1,2,3,4,5,6-hexol (CAS 287112-34-9) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 188.13 g/mol. IUPAC name: (2R,3R,4R,5R)-(1,2,3,4,5,6-13C6)hexane-1,2,3,4,5,6-hexol. InChIKey: FBPFZTCFMRRESA-CRWJSTOYSA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | (2R,3R,4R,5R)-(1,2,3,4,5,6-13C6)hexane-1,2,3,4,5,6-hexol |
| InChIKey | FBPFZTCFMRRESA-CRWJSTOYSA-N |
| SMILES | [13CH2]([13C@H]([13C@H]([13C@@H]([13C@@H]([13CH2]O)O)O)O)O)O |
Computed by PubChem (NCBI)