CAS 18265-46-8 appears in our catalog under these names: D–Ribose 5–phosphate disodium, D-Ribose-5-phosphate disodium salt hydrate, 85% , D-Ribose-5-phosphate disodium salt hydrate, D-Ribose-5-phosphate disodium salt hydrate, 85.00%, D-Ribose 5-phosphate disodium 85%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Ambeed. Available pack sizes: 10mg, 5mg, 10mM (in 1ml water), 1g, 250mg, 0,5g, 0,1g, 100mg.
Disodium;(2R,3S,4R)-4-hydroxy-1-oxo-5-phosphonooxypentane-2,3-diolate (CAS 18265-46-8) is a chemical compound with the molecular formula C5H9Na2O8P and a molecular weight of 274.07 g/mol. IUPAC name: disodium;(2R,3S,4R)-4-hydroxy-1-oxo-5-phosphonooxypentane-2,3-diolate. InChIKey: WLPAKKFQVSXILQ-LMQMBFIUSA-N.
| Molecular formula | C5H9Na2O8P |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | disodium;(2R,3S,4R)-4-hydroxy-1-oxo-5-phosphonooxypentane-2,3-diolate |
| InChIKey | WLPAKKFQVSXILQ-LMQMBFIUSA-N |
| SMILES | C([C@H]([C@H]([C@H](C=O)[O-])[O-])O)OP(=O)(O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)