CAS 220551-92-8 appears in our catalog under these names: DAA-1106, 98+%, DAA-1106/ 99.94% (existing batch purity), DAA–1106, DAA-1106, 98%, 98%, DAA-1106, 99.93%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 10mM (in 1ml dmso), 50mg, 100mg, 250mg, 50 mg.
N-[(2,5-dimethoxyphenyl)methyl]-N-(5-fluoro-2-phenoxyphenyl)acetamide (CAS 220551-92-8) is a chemical compound with the molecular formula C23H22FNO4 and a molecular weight of 395.4 g/mol. IUPAC name: N-[(2,5-dimethoxyphenyl)methyl]-N-(5-fluoro-2-phenoxyphenyl)acetamide. InChIKey: DCRZYADKQRHHSF-UHFFFAOYSA-N.
| Molecular formula | C23H22FNO4 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | N-[(2,5-dimethoxyphenyl)methyl]-N-(5-fluoro-2-phenoxyphenyl)acetamide |
| InChIKey | DCRZYADKQRHHSF-UHFFFAOYSA-N |
| SMILES | CC(=O)N(CC1=C(C=CC(=C1)OC)OC)C2=C(C=CC(=C2)F)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)