DBCO-PEG4 amine, 95% (TFA salt)
cas: 1255942-08-5 — see every product listed under this CAS number, including other names
DBCO-PEG4 amine, 95% (TFA salt) (CAS 1255942-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A756311-100mg |
| cas | 1255942-08-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2384.00 Pln | |
| Ambeed | 250mg | 3997.12 Pln | |
| Chemat | 10mg | 525.20 Pln | |
| Chemat | 25mg | 986.00 Pln | |
| Chemat | 50mg | 1634.00 Pln | |
| Chemat | 100mg | 2733.20 Pln | |
| Chemat | 250mg | 4600.40 Pln | |
| BLDpharm | 10mg | 503.18 Pln | |
| BLDpharm | 25mg | 936.36 Pln | |
| BLDpharm | 50mg | 1541.70 Pln | |
| BLDpharm | 100mg | 2563.57 Pln | |
| BLDpharm | 250mg | 4301.84 Pln |
properties
| purity | 95% (TFA salt) |
|---|---|
| delivery time | 1-2 weeks |
3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]propanamide (CAS 1255942-08-5) is a chemical compound with the molecular formula C29H37N3O6 and a molecular weight of 523.6 g/mol. IUPAC name: 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]propanamide. InChIKey: KTIOBJVNCOFWCL-UHFFFAOYSA-N.
| Molecular formula | C29H37N3O6 |
|---|---|
| Molecular weight | 523.6 g/mol |
| IUPAC name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]propanamide |
| InChIKey | KTIOBJVNCOFWCL-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCNC(=O)CCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)