DBCO-PEG4 amine, 95%, 95%
cas: 1255942-08-5 — see every product listed under this CAS number, including other names
DBCO-PEG4 amine, 95%, 95% (CAS 1255942-08-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HICB-10mg |
| cas | 1255942-08-5 |
| size | 10mg |
| availability | 1.25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 410.00 Pln | |
| Chemat | 25mg | 760.40 Pln | |
| Chemat | 50mg | 1245.20 Pln | |
| Chemat | 100mg | 2075.60 Pln | |
| Chemat | 250mg | 3482.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]propanamide (CAS 1255942-08-5) is a chemical compound with the molecular formula C29H37N3O6 and a molecular weight of 523.6 g/mol. IUPAC name: 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]propanamide. InChIKey: KTIOBJVNCOFWCL-UHFFFAOYSA-N.
| Molecular formula | C29H37N3O6 |
|---|---|
| Molecular weight | 523.6 g/mol |
| IUPAC name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]propanamide |
| InChIKey | KTIOBJVNCOFWCL-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCNC(=O)CCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)