cas: 1872387-43-3 — see every product listed under this CAS number, including other names
DC661 98% (CAS 1872387-43-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1001762-1mg |
| cas | 1872387-43-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 203.50 Pln | |
| Ambeed | 5mg | 364.81 Pln | |
| Ambeed | 10mg | 498.31 Pln | |
| Ambeed | 25mg | 787.56 Pln | |
| Ambeed | 50mg | 1316.00 Pln | |
| Ambeed | 100mg | 2167.06 Pln | |
| Ambeed | 250mg | 3630.00 Pln | |
| Ambeed | 1g | 9682.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1001762 |
N-(7-chloroquinolin-4-yl)-N'-[6-[(7-chloroquinolin-4-yl)amino]hexyl]-N'-methylhexane-1,6-diamine (CAS 1872387-43-3) is a chemical compound with the molecular formula C31H39Cl2N5 and a molecular weight of 552.6 g/mol. IUPAC name: N-(7-chloroquinolin-4-yl)-N'-[6-[(7-chloroquinolin-4-yl)amino]hexyl]-N'-methylhexane-1,6-diamine. InChIKey: VJKCWFZTSDXOBS-UHFFFAOYSA-N.
| Molecular formula | C31H39Cl2N5 |
|---|---|
| Molecular weight | 552.6 g/mol |
| IUPAC name | N-(7-chloroquinolin-4-yl)-N'-[6-[(7-chloroquinolin-4-yl)amino]hexyl]-N'-methylhexane-1,6-diamine |
| InChIKey | VJKCWFZTSDXOBS-UHFFFAOYSA-N |
| SMILES | CN(CCCCCCNC1=C2C=CC(=CC2=NC=C1)Cl)CCCCCCNC3=C4C=CC(=CC4=NC=C3)Cl |
Computed by PubChem (NCBI)