cas: 200052-70-6 — see every product listed under this CAS number, including other names
DCJTB 98% (CAS 200052-70-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A417663-100mg |
| cas | 200052-70-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 726.38 Pln | |
| Ambeed | 250mg | 1371.62 Pln | |
| Ambeed | 1g | 5020.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A417663 |
2-[2-tert-butyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]propanedinitrile (CAS 200052-70-6) is a chemical compound with the molecular formula C30H35N3O and a molecular weight of 453.6 g/mol. IUPAC name: 2-[2-tert-butyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]propanedinitrile. InChIKey: HXWWMGJBPGRWRS-CMDGGOBGSA-N.
| Molecular formula | C30H35N3O |
|---|---|
| Molecular weight | 453.6 g/mol |
| IUPAC name | 2-[2-tert-butyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]pyran-4-ylidene]propanedinitrile |
| InChIKey | HXWWMGJBPGRWRS-CMDGGOBGSA-N |
| SMILES | CC1(CCN2CCC(C3=C2C1=CC(=C3)/C=C/C4=CC(=C(C#N)C#N)C=C(O4)C(C)(C)C)(C)C)C |
Computed by PubChem (NCBI)