cas: 1464788-84-8 — see every product listed under this CAS number, including other names
DI-TERT-BUTYL (4-CHLOROPYRIMIDIN-2-YL)CARBAMATE, 95% (CAS 1464788-84-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F475060-1G |
| cas | 1464788-84-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 893.45 Pln | |
| Fluorochem | 10g | 1502.61 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-chloropyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1464788-84-8) is a chemical compound with the molecular formula C14H20ClN3O4 and a molecular weight of 329.78 g/mol. IUPAC name: tert-butyl N-(4-chloropyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: LTWPYVSBBSMSNR-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN3O4 |
|---|---|
| Molecular weight | 329.78 g/mol |
| IUPAC name | tert-butyl N-(4-chloropyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | LTWPYVSBBSMSNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC=CC(=N1)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)